C19H15ClF4N2O3 — CID 55716725
[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone (PubChem CID 55716725) has the molecular formula C19H15ClF4N2O3 and a molecular weight of 430.79 g/mol. Its IUPAC name is [4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 55716725 |
| Molecular Formula | C19H15ClF4N2O3 |
| Molecular Weight | 430.79 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | [4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OC(F)(F)F)cc1)N1CCN(C(=O)c2cc(Cl)ccc2F)CC1 |
| InChI | InChI=1S/C19H15ClF4N2O3/c20-13-3-6-16(21)15(11-13)18(28)26-9-7-25(8-10-26)17(27)12-1-4-14(5-2-12)29-19(22,23)24/h1-6,11H,7-10H2 |
| InChIKey | RRAZKFIYVZNYKV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.79 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |