C14H16F3NO3 — CID 80701731
(4-hydroxy-4-methylpiperidin-1-yl)-[4-(trifluoromethoxy)phenyl]methanone (PubChem CID 80701731) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is (4-hydroxy-4-methylpiperidin-1-yl)-[4-(trifluoromethoxy)phenyl]methanone.
| Compound Name | (4-hydroxy-4-methylpiperidin-1-yl)-[4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 80701731 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (4-hydroxy-4-methylpiperidin-1-yl)-[4-(trifluoromethoxy)phenyl]methanone |
| SMILES | CC1(O)CCN(C(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C14H16F3NO3/c1-13(20)6-8-18(9-7-13)12(19)10-2-4-11(5-3-10)21-14(15,16)17/h2-5,20H,6-9H2,1H3 |
| InChIKey | HTEPFSOBXNACCN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |