C20H18F3NO4 — CID 45433546
4-phenyl-1-[4-(trifluoromethoxy)benzoyl]piperidine-4-carboxylic acid (PubChem CID 45433546) has the molecular formula C20H18F3NO4 and a molecular weight of 393.36 g/mol. Its IUPAC name is 4-phenyl-1-[4-(trifluoromethoxy)benzoyl]piperidine-4-carboxylic acid.
| Compound Name | 4-phenyl-1-[4-(trifluoromethoxy)benzoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 45433546 |
| Molecular Formula | C20H18F3NO4 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 4-phenyl-1-[4-(trifluoromethoxy)benzoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(c1ccc(OC(F)(F)F)cc1)N1CCC(C(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H18F3NO4/c21-20(22,23)28-16-8-6-14(7-9-16)17(25)24-12-10-19(11-13-24,18(26)27)15-4-2-1-3-5-15/h1-9H,10-13H2,(H,26,27) |
| InChIKey | BFAMIKXILJYLNV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |