C14H14F3NO5 — CID 120528203
4-hydroxy-1-[3-(trifluoromethoxy)benzoyl]piperidine-4-carboxylic acid (PubChem CID 120528203) has the molecular formula C14H14F3NO5 and a molecular weight of 333.26 g/mol. Its IUPAC name is 4-hydroxy-1-[3-(trifluoromethoxy)benzoyl]piperidine-4-carboxylic acid.
| Compound Name | 4-hydroxy-1-[3-(trifluoromethoxy)benzoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 120528203 |
| Molecular Formula | C14H14F3NO5 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4-hydroxy-1-[3-(trifluoromethoxy)benzoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(c1cccc(OC(F)(F)F)c1)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C14H14F3NO5/c15-14(16,17)23-10-3-1-2-9(8-10)11(19)18-6-4-13(22,5-7-18)12(20)21/h1-3,8,22H,4-7H2,(H,20,21) |
| InChIKey | XRHVGYPKMBQARN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |