C16H23NO3 — CID 81103143
(4-hydroxy-4-methylpiperidin-1-yl)-(3-propan-2-yloxyphenyl)methanone (PubChem CID 81103143) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (4-hydroxy-4-methylpiperidin-1-yl)-(3-propan-2-yloxyphenyl)methanone.
| Compound Name | (4-hydroxy-4-methylpiperidin-1-yl)-(3-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 81103143 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (4-hydroxy-4-methylpiperidin-1-yl)-(3-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1cccc(C(=O)N2CCC(C)(O)CC2)c1 |
| InChI | InChI=1S/C16H23NO3/c1-12(2)20-14-6-4-5-13(11-14)15(18)17-9-7-16(3,19)8-10-17/h4-6,11-12,19H,7-10H2,1-3H3 |
| InChIKey | VPAXZTUGWCFQLL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |