C16H21F2NO3 — CID 124889245
[3-(difluoromethoxy)phenyl]-[(4S)-4-methoxy-4-methylazepan-1-yl]methanone (PubChem CID 124889245) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is [3-(difluoromethoxy)phenyl]-[(4S)-4-methoxy-4-methylazepan-1-yl]methanone.
| Compound Name | [3-(difluoromethoxy)phenyl]-[(4S)-4-methoxy-4-methylazepan-1-yl]methanone |
|---|---|
| PubChem CID | 124889245 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [3-(difluoromethoxy)phenyl]-[(4S)-4-methoxy-4-methylazepan-1-yl]methanone |
| SMILES | CO[C@@]1(C)CCCN(C(=O)c2cccc(OC(F)F)c2)CC1 |
| InChI | InChI=1S/C16H21F2NO3/c1-16(21-2)7-4-9-19(10-8-16)14(20)12-5-3-6-13(11-12)22-15(17)18/h3,5-6,11,15H,4,7-10H2,1-2H3/t16-/m0/s1 |
| InChIKey | SJUJQAOIQGLSNJ-INIZCTEOSA-N |
| XLogP | 3.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |