C20H22F2N2O3 — CID 19297405
[3-(difluoromethoxy)phenyl]-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 19297405) has the molecular formula C20H22F2N2O3 and a molecular weight of 376.40 g/mol. Its IUPAC name is [3-(difluoromethoxy)phenyl]-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [3-(difluoromethoxy)phenyl]-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19297405 |
| Molecular Formula | C20H22F2N2O3 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [3-(difluoromethoxy)phenyl]-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | COc1cccc(CN2CCN(C(=O)c3cccc(OC(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C20H22F2N2O3/c1-26-17-6-2-4-15(12-17)14-23-8-10-24(11-9-23)19(25)16-5-3-7-18(13-16)27-20(21)22/h2-7,12-13,20H,8-11,14H2,1H3 |
| InChIKey | GOPJCHNCHQYBKS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |