C14H17ClF2N2O2 — CID 63395341
[4-(2-chloroethyl)piperazin-1-yl]-[3-(difluoromethoxy)phenyl]methanone (PubChem CID 63395341) has the molecular formula C14H17ClF2N2O2 and a molecular weight of 318.75 g/mol. Its IUPAC name is [4-(2-chloroethyl)piperazin-1-yl]-[3-(difluoromethoxy)phenyl]methanone.
| Compound Name | [4-(2-chloroethyl)piperazin-1-yl]-[3-(difluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 63395341 |
| Molecular Formula | C14H17ClF2N2O2 |
| Molecular Weight | 318.75 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | [4-(2-chloroethyl)piperazin-1-yl]-[3-(difluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1cccc(OC(F)F)c1)N1CCN(CCCl)CC1 |
| InChI | InChI=1S/C14H17ClF2N2O2/c15-4-5-18-6-8-19(9-7-18)13(20)11-2-1-3-12(10-11)21-14(16)17/h1-3,10,14H,4-9H2 |
| InChIKey | UPWZRDFFCWTJTI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.75 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|