C13H17F2N2O2+ — CID 2312190
[3-(difluoromethoxy)phenyl]-(4-methylpiperazin-4-ium-1-yl)methanone (PubChem CID 2312190) has the molecular formula C13H17F2N2O2+ and a molecular weight of 271.29 g/mol. Its IUPAC name is [3-(difluoromethoxy)phenyl]-(4-methylpiperazin-4-ium-1-yl)methanone.
| Compound Name | [3-(difluoromethoxy)phenyl]-(4-methylpiperazin-4-ium-1-yl)methanone |
|---|---|
| PubChem CID | 2312190 |
| Molecular Formula | C13H17F2N2O2+ |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | [3-(difluoromethoxy)phenyl]-(4-methylpiperazin-4-ium-1-yl)methanone |
| SMILES | C[NH+]1CCN(C(=O)c2cccc(OC(F)F)c2)CC1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-16-5-7-17(8-6-16)12(18)10-3-2-4-11(9-10)19-13(14)15/h2-4,9,13H,5-8H2,1H3/p+1 |
| InChIKey | ODDUPYQOBHAOSA-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |