C15H21F2N2O2+ — CID 7428120
3-(difluoromethoxy)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)benzamide (PubChem CID 7428120) has the molecular formula C15H21F2N2O2+ and a molecular weight of 299.34 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)benzamide.
| Compound Name | 3-(difluoromethoxy)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)benzamide |
|---|---|
| PubChem CID | 7428120 |
| Molecular Formula | C15H21F2N2O2+ |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 3-(difluoromethoxy)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)benzamide |
| SMILES | CN(C(=O)c1cccc(OC(F)F)c1)C1CC[NH+](C)CC1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-18-8-6-12(7-9-18)19(2)14(20)11-4-3-5-13(10-11)21-15(16)17/h3-5,10,12,15H,6-9H2,1-2H3/p+1 |
| InChIKey | VWJGTFCAYDZYOF-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |