C18H22F2N3O2+ — CID 2314263
(E)-2-cyano-3-[4-(difluoromethoxy)phenyl]-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)prop-2-enamide (PubChem CID 2314263) has the molecular formula C18H22F2N3O2+ and a molecular weight of 350.39 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(difluoromethoxy)phenyl]-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(difluoromethoxy)phenyl]-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2314263 |
| Molecular Formula | C18H22F2N3O2+ |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (E)-2-cyano-3-[4-(difluoromethoxy)phenyl]-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)prop-2-enamide |
| SMILES | CN(C(=O)/C(C#N)=C/c1ccc(OC(F)F)cc1)C1CC[NH+](C)CC1 |
| InChI | InChI=1S/C18H21F2N3O2/c1-22-9-7-15(8-10-22)23(2)17(24)14(12-21)11-13-3-5-16(6-4-13)25-18(19)20/h3-6,11,15,18H,7-10H2,1-2H3/p+1/b14-11+ |
| InChIKey | FHFVYDORPQGKJV-SDNWHVSQSA-O |
| XLogP | 1.33 |
| TPSA | 57.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|