C16H10BrF2N3O2 — CID 4571725
N-(5-bromo-2-pyridinyl)-2-cyano-3-[4-(difluoromethoxy)phenyl]prop-2-enamide (PubChem CID 4571725) has the molecular formula C16H10BrF2N3O2 and a molecular weight of 394.18 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-cyano-3-[4-(difluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-cyano-3-[4-(difluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4571725 |
| Molecular Formula | C16H10BrF2N3O2 |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-cyano-3-[4-(difluoromethoxy)phenyl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(OC(F)F)cc1)C(=O)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C16H10BrF2N3O2/c17-12-3-6-14(21-9-12)22-15(23)11(8-20)7-10-1-4-13(5-2-10)24-16(18)19/h1-7,9,16H,(H,21,22,23) |
| InChIKey | JOHARBCRVOLBBD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|