C15H16F2N2O2 — CID 2314698
(Z)-2-cyano-3-[4-(difluoromethoxy)phenyl]-N,N-diethylprop-2-enamide (PubChem CID 2314698) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(difluoromethoxy)phenyl]-N,N-diethylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(difluoromethoxy)phenyl]-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 2314698 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (Z)-2-cyano-3-[4-(difluoromethoxy)phenyl]-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C(C#N)=C\c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H16F2N2O2/c1-3-19(4-2)14(20)12(10-18)9-11-5-7-13(8-6-11)21-15(16)17/h5-9,15H,3-4H2,1-2H3/b12-9- |
| InChIKey | CBJGBDWWZXXEJN-XFXZXTDPSA-N |
| XLogP | 3.06 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|