C14H12BrF2N3OS — CID 24741150
1-(5-bromo-2-pyridinyl)-3-[[4-(difluoromethoxy)phenyl]methyl]thiourea (PubChem CID 24741150) has the molecular formula C14H12BrF2N3OS and a molecular weight of 388.24 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-[[4-(difluoromethoxy)phenyl]methyl]thiourea.
| Compound Name | 1-(5-bromo-2-pyridinyl)-3-[[4-(difluoromethoxy)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 24741150 |
| Molecular Formula | C14H12BrF2N3OS |
| Molecular Weight | 388.24 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-[[4-(difluoromethoxy)phenyl]methyl]thiourea |
| SMILES | FC(F)Oc1ccc(CNC(=S)Nc2ccc(Br)cn2)cc1 |
| InChI | InChI=1S/C14H12BrF2N3OS/c15-10-3-6-12(18-8-10)20-14(22)19-7-9-1-4-11(5-2-9)21-13(16)17/h1-6,8,13H,7H2,(H2,18,19,20,22) |
| InChIKey | MRAVXCUPIGYUCF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.24 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|