C11H11F5N2OS — CID 14774199
1-[[4-(difluoromethoxy)phenyl]methyl]-3-(2,2,2-trifluoroethyl)thiourea (PubChem CID 14774199) has the molecular formula C11H11F5N2OS and a molecular weight of 314.28 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(2,2,2-trifluoroethyl)thiourea.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 14774199 |
| Molecular Formula | C11H11F5N2OS |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(2,2,2-trifluoroethyl)thiourea |
| SMILES | FC(F)Oc1ccc(CNC(=S)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F5N2OS/c12-9(13)19-8-3-1-7(2-4-8)5-17-10(20)18-6-11(14,15)16/h1-4,9H,5-6H2,(H2,17,18,20) |
| InChIKey | VSGJXEZBFTUOMW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|