C10H11F2NO2 — CID 51072984
N-[[4-(difluoromethoxy)phenyl]methyl]acetamide (PubChem CID 51072984) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 51072984 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C10H11F2NO2/c1-7(14)13-6-8-2-4-9(5-3-8)15-10(11)12/h2-5,10H,6H2,1H3,(H,13,14) |
| InChIKey | QFULNIDEXJIJCJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |