C13H18F2N2O2 — CID 79012907
(2R)-2-amino-N-[[4-(difluoromethoxy)phenyl]methyl]-3-methylbutanamide (PubChem CID 79012907) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2R)-2-amino-N-[[4-(difluoromethoxy)phenyl]methyl]-3-methylbutanamide.
| Compound Name | (2R)-2-amino-N-[[4-(difluoromethoxy)phenyl]methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 79012907 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (2R)-2-amino-N-[[4-(difluoromethoxy)phenyl]methyl]-3-methylbutanamide |
| SMILES | CC(C)[C@@H](N)C(=O)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H18F2N2O2/c1-8(2)11(16)12(18)17-7-9-3-5-10(6-4-9)19-13(14)15/h3-6,8,11,13H,7,16H2,1-2H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | GYVKPZSXXPXSHH-LLVKDONJSA-N |
| XLogP | 1.89 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |