C20H22F2N2O2 — CID 96581020
3-(difluoromethoxy)-N-methyl-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]benzamide (PubChem CID 96581020) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-methyl-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]benzamide.
| Compound Name | 3-(difluoromethoxy)-N-methyl-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 96581020 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-(difluoromethoxy)-N-methyl-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]benzamide |
| SMILES | CN(C[C@@H]1CCN(c2ccccc2)C1)C(=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C20H22F2N2O2/c1-23(19(25)16-6-5-9-18(12-16)26-20(21)22)13-15-10-11-24(14-15)17-7-3-2-4-8-17/h2-9,12,15,20H,10-11,13-14H2,1H3/t15-/m0/s1 |
| InChIKey | PKHABXYVWZCOTP-HNNXBMFYSA-N |
| XLogP | 3.89 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |