C22H28F2N4O — CID 111288233
1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(1-phenylpyrrolidin-3-yl)methyl]guanidine (PubChem CID 111288233) has the molecular formula C22H28F2N4O and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(1-phenylpyrrolidin-3-yl)methyl]guanidine.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(1-phenylpyrrolidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111288233 |
| Molecular Formula | C22H28F2N4O |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(1-phenylpyrrolidin-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCC1CCN(c2ccccc2)C1)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H28F2N4O/c1-25-22(27(2)15-17-8-10-20(11-9-17)29-21(23)24)26-14-18-12-13-28(16-18)19-6-4-3-5-7-19/h3-11,18,21H,12-16H2,1-2H3,(H,25,26) |
| InChIKey | PUDRCAZEVSNHOM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|