C18H28F2N4O3S — CID 111287707
1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine (PubChem CID 111287707) has the molecular formula C18H28F2N4O3S and a molecular weight of 418.51 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111287707 |
| Molecular Formula | C18H28F2N4O3S |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC1CCN(S(C)(=O)=O)CC1)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H28F2N4O3S/c1-21-18(22-12-14-8-10-24(11-9-14)28(3,25)26)23(2)13-15-4-6-16(7-5-15)27-17(19)20/h4-7,14,17H,8-13H2,1-3H3,(H,21,22) |
| InChIKey | NZFUSHJQVJGBJL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|