C18H25F5N4O — CID 111288101
1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine (PubChem CID 111288101) has the molecular formula C18H25F5N4O and a molecular weight of 408.42 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111288101 |
| Molecular Formula | C18H25F5N4O |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
| SMILES | C/N=C(\NCC1CCN(CC(F)(F)F)C1)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H25F5N4O/c1-24-17(25-9-14-7-8-27(11-14)12-18(21,22)23)26(2)10-13-3-5-15(6-4-13)28-16(19)20/h3-6,14,16H,7-12H2,1-2H3,(H,24,25) |
| InChIKey | AVTVULRVVVLEOT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|