C19H30F3IN4 — CID 111283074
1-[(4-ethylphenyl)methyl]-1,2-dimethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111283074) has the molecular formula C19H30F3IN4 and a molecular weight of 498.38 g/mol. Its IUPAC name is 1-[(4-ethylphenyl)methyl]-1,2-dimethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-ethylphenyl)methyl]-1,2-dimethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111283074 |
| Molecular Formula | C19H30F3IN4 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 1-[(4-ethylphenyl)methyl]-1,2-dimethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | CCc1ccc(CN(C)/C(=N/C)NCC2CCN(CC(F)(F)F)C2)cc1.I |
| InChI | InChI=1S/C19H29F3N4.HI/c1-4-15-5-7-16(8-6-15)12-25(3)18(23-2)24-11-17-9-10-26(13-17)14-19(20,21)22;/h5-8,17H,4,9-14H2,1-3H3,(H,23,24);1H |
| InChIKey | FGCSYOJTAQPCJL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|