C19H32N4 — CID 111289215
3-[(1-ethylpiperidin-3-yl)methyl]-1,2-dimethyl-1-[(4-methylphenyl)methyl]guanidine (PubChem CID 111289215) has the molecular formula C19H32N4 and a molecular weight of 316.49 g/mol. Its IUPAC name is 3-[(1-ethylpiperidin-3-yl)methyl]-1,2-dimethyl-1-[(4-methylphenyl)methyl]guanidine.
| Compound Name | 3-[(1-ethylpiperidin-3-yl)methyl]-1,2-dimethyl-1-[(4-methylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111289215 |
| Molecular Formula | C19H32N4 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 3-[(1-ethylpiperidin-3-yl)methyl]-1,2-dimethyl-1-[(4-methylphenyl)methyl]guanidine |
| SMILES | CCN1CCCC(CN/C(=N/C)N(C)Cc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C19H32N4/c1-5-23-12-6-7-18(15-23)13-21-19(20-3)22(4)14-17-10-8-16(2)9-11-17/h8-11,18H,5-7,12-15H2,1-4H3,(H,20,21) |
| InChIKey | QQBLRUMBANACBJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|