C14H21BrIN3 — CID 111292858
1-[(4-bromophenyl)methyl]-3-(cyclopropylmethyl)-1,2-dimethylguanidine;hydroiodide (PubChem CID 111292858) has the molecular formula C14H21BrIN3 and a molecular weight of 438.15 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-(cyclopropylmethyl)-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-(cyclopropylmethyl)-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111292858 |
| Molecular Formula | C14H21BrIN3 |
| Molecular Weight | 438.15 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-(cyclopropylmethyl)-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CC1)N(C)Cc1ccc(Br)cc1.I |
| InChI | InChI=1S/C14H20BrN3.HI/c1-16-14(17-9-11-3-4-11)18(2)10-12-5-7-13(15)8-6-12;/h5-8,11H,3-4,9-10H2,1-2H3,(H,16,17);1H |
| InChIKey | JLTVSMLITVXRBY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.15 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|