C16H27BrN4 — CID 111293261
1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[2-[methyl(propan-2-yl)amino]ethyl]guanidine (PubChem CID 111293261) has the molecular formula C16H27BrN4 and a molecular weight of 355.32 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[2-[methyl(propan-2-yl)amino]ethyl]guanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[2-[methyl(propan-2-yl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111293261 |
| Molecular Formula | C16H27BrN4 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[2-[methyl(propan-2-yl)amino]ethyl]guanidine |
| SMILES | C/N=C(\NCCN(C)C(C)C)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H27BrN4/c1-13(2)20(4)11-10-19-16(18-3)21(5)12-14-6-8-15(17)9-7-14/h6-9,13H,10-12H2,1-5H3,(H,18,19) |
| InChIKey | XENSUXMUOLNPOL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|