C20H25BrN4O — CID 111292771
N-[4-[2-[[N-[(4-bromophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]phenyl]acetamide (PubChem CID 111292771) has the molecular formula C20H25BrN4O and a molecular weight of 417.35 g/mol. Its IUPAC name is N-[4-[2-[[N-[(4-bromophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[[N-[(4-bromophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 111292771 |
| Molecular Formula | C20H25BrN4O |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[4-[2-[[N-[(4-bromophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]phenyl]acetamide |
| SMILES | C/N=C(/NCCc1ccc(NC(C)=O)cc1)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H25BrN4O/c1-15(26)24-19-10-6-16(7-11-19)12-13-23-20(22-2)25(3)14-17-4-8-18(21)9-5-17/h4-11H,12-14H2,1-3H3,(H,22,23)(H,24,26) |
| InChIKey | LCEXDYNLBNWSHX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|