C21H26F2N4O2 — CID 111287683
N-[4-[2-[[N-[[4-(difluoromethoxy)phenyl]methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]phenyl]acetamide (PubChem CID 111287683) has the molecular formula C21H26F2N4O2 and a molecular weight of 404.46 g/mol. Its IUPAC name is N-[4-[2-[[N-[[4-(difluoromethoxy)phenyl]methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[[N-[[4-(difluoromethoxy)phenyl]methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 111287683 |
| Molecular Formula | C21H26F2N4O2 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-[4-[2-[[N-[[4-(difluoromethoxy)phenyl]methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]phenyl]acetamide |
| SMILES | C/N=C(/NCCc1ccc(NC(C)=O)cc1)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H26F2N4O2/c1-15(28)26-18-8-4-16(5-9-18)12-13-25-21(24-2)27(3)14-17-6-10-19(11-7-17)29-20(22)23/h4-11,20H,12-14H2,1-3H3,(H,24,25)(H,26,28) |
| InChIKey | NHXDQCHWHVQMFE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|