C18H24F2N4OS — CID 111287715
1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1,2-dimethylguanidine (PubChem CID 111287715) has the molecular formula C18H24F2N4OS and a molecular weight of 382.48 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1,2-dimethylguanidine.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111287715 |
| Molecular Formula | C18H24F2N4OS |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1,2-dimethylguanidine |
| SMILES | CCc1nc(CCN/C(=N\C)N(C)Cc2ccc(OC(F)F)cc2)cs1 |
| InChI | InChI=1S/C18H24F2N4OS/c1-4-16-23-14(12-26-16)9-10-22-18(21-2)24(3)11-13-5-7-15(8-6-13)25-17(19)20/h5-8,12,17H,4,9-11H2,1-3H3,(H,21,22) |
| InChIKey | DLIYHOUXYONNBH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|