C17H23BrN4S — CID 111292791
1-[(4-bromophenyl)methyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1,2-dimethylguanidine (PubChem CID 111292791) has the molecular formula C17H23BrN4S and a molecular weight of 395.37 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111292791 |
| Molecular Formula | C17H23BrN4S |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1,2-dimethylguanidine |
| SMILES | CCc1nc(CCN/C(=N\C)N(C)Cc2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C17H23BrN4S/c1-4-16-21-15(12-23-16)9-10-20-17(19-2)22(3)11-13-5-7-14(18)8-6-13/h5-8,12H,4,9-11H2,1-3H3,(H,19,20) |
| InChIKey | ZLLGZJYGCOBHFH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|