C16H20BrN5 — CID 119131520
1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine (PubChem CID 119131520) has the molecular formula C16H20BrN5 and a molecular weight of 362.28 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119131520 |
| Molecular Formula | C16H20BrN5 |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccnc(C)n1)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H20BrN5/c1-12-19-9-8-15(21-12)10-20-16(18-2)22(3)11-13-4-6-14(17)7-5-13/h4-9H,10-11H2,1-3H3,(H,18,20) |
| InChIKey | OHRIOHGLDOCYRO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|