C17H22BrIN4O — CID 111293346
1-[(4-bromophenyl)methyl]-3-[(2-methoxy-4-pyridinyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111293346) has the molecular formula C17H22BrIN4O and a molecular weight of 505.20 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-[(2-methoxy-4-pyridinyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-[(2-methoxy-4-pyridinyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111293346 |
| Molecular Formula | C17H22BrIN4O |
| Molecular Weight | 505.20 g/mol |
| Exact Mass | 504.00 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-[(2-methoxy-4-pyridinyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccnc(OC)c1)N(C)Cc1ccc(Br)cc1.I |
| InChI | InChI=1S/C17H21BrN4O.HI/c1-19-17(21-11-14-8-9-20-16(10-14)23-3)22(2)12-13-4-6-15(18)7-5-13;/h4-10H,11-12H2,1-3H3,(H,19,21);1H |
| InChIKey | YSDUAIUNDBAHSV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.20 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|