C23H35IN6O — CID 111272286
3-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-1-[(4-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111272286) has the molecular formula C23H35IN6O and a molecular weight of 538.48 g/mol. Its IUPAC name is 3-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-1-[(4-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-1-[(4-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111272286 |
| Molecular Formula | C23H35IN6O |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 3-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-1-[(4-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCN1CCN(c2cc(CN/C(=N/C)N(C)Cc3ccc(OC)cc3)ccn2)CC1.I |
| InChI | InChI=1S/C23H34N6O.HI/c1-5-28-12-14-29(15-13-28)22-16-20(10-11-25-22)17-26-23(24-2)27(3)18-19-6-8-21(30-4)9-7-19;/h6-11,16H,5,12-15,17-18H2,1-4H3,(H,24,26);1H |
| InChIKey | LQCKPRJPZFWRFH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|