C22H32FIN6 — CID 111285876
3-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-1-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111285876) has the molecular formula C22H32FIN6 and a molecular weight of 526.44 g/mol. Its IUPAC name is 3-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-1-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-1-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111285876 |
| Molecular Formula | C22H32FIN6 |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 3-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-1-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCN1CCN(c2cc(CN/C(=N/C)N(C)Cc3cccc(F)c3)ccn2)CC1.I |
| InChI | InChI=1S/C22H31FN6.HI/c1-4-28-10-12-29(13-11-28)21-15-18(8-9-25-21)16-26-22(24-2)27(3)17-19-6-5-7-20(23)14-19;/h5-9,14-15H,4,10-13,16-17H2,1-3H3,(H,24,26);1H |
| InChIKey | CMYHTTDVADHNER-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|