C14H19FIN5 — CID 111285140
1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide (PubChem CID 111285140) has the molecular formula C14H19FIN5 and a molecular weight of 403.24 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111285140 |
| Molecular Formula | C14H19FIN5 |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccn[nH]1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C14H18FN5.HI/c1-16-14(17-9-13-6-7-18-19-13)20(2)10-11-4-3-5-12(15)8-11;/h3-8H,9-10H2,1-2H3,(H,16,17)(H,18,19);1H |
| InChIKey | SXXQXUVATKUYHX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|