C19H25FIN3O2S — CID 111286132
1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111286132) has the molecular formula C19H25FIN3O2S and a molecular weight of 505.40 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111286132 |
| Molecular Formula | C19H25FIN3O2S |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(CS(C)(=O)=O)cc1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C19H24FN3O2S.HI/c1-21-19(23(2)13-17-5-4-6-18(20)11-17)22-12-15-7-9-16(10-8-15)14-26(3,24)25;/h4-11H,12-14H2,1-3H3,(H,21,22);1H |
| InChIKey | DCZXXZMTFVCODZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|