C18H23FN4O2S — CID 119131430
1-[(3-fluorophenyl)methyl]-3-[[3-(methanesulfonamido)phenyl]methyl]-1,2-dimethylguanidine (PubChem CID 119131430) has the molecular formula C18H23FN4O2S and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-3-[[3-(methanesulfonamido)phenyl]methyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(3-fluorophenyl)methyl]-3-[[3-(methanesulfonamido)phenyl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 119131430 |
| Molecular Formula | C18H23FN4O2S |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-3-[[3-(methanesulfonamido)phenyl]methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCc1cccc(NS(C)(=O)=O)c1)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C18H23FN4O2S/c1-20-18(23(2)13-15-7-4-8-16(19)10-15)21-12-14-6-5-9-17(11-14)22-26(3,24)25/h4-11,22H,12-13H2,1-3H3,(H,20,21) |
| InChIKey | NUUYJLLDKDCIRY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|