C21H29FIN5O — CID 111286432
1-[4-[[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide (PubChem CID 111286432) has the molecular formula C21H29FIN5O and a molecular weight of 513.40 g/mol. Its IUPAC name is 1-[4-[[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide.
| Compound Name | 1-[4-[[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
|---|---|
| PubChem CID | 111286432 |
| Molecular Formula | C21H29FIN5O |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 1-[4-[[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(NC(=O)NC(C)C)cc1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C21H28FN5O.HI/c1-15(2)25-21(28)26-19-10-8-16(9-11-19)13-24-20(23-3)27(4)14-17-6-5-7-18(22)12-17;/h5-12,15H,13-14H2,1-4H3,(H,23,24)(H2,25,26,28);1H |
| InChIKey | DTRDCAYTUMFTMW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|