C23H32FN5O — CID 111624696
1-[4-[[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 111624696) has the molecular formula C23H32FN5O and a molecular weight of 413.54 g/mol. Its IUPAC name is 1-[4-[[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 111624696 |
| Molecular Formula | C23H32FN5O |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 1-[4-[[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | C/N=C(/NCc1ccc(NC(=O)NC(C)C)cc1)NCC(C)(C)c1cccc(F)c1 |
| InChI | InChI=1S/C23H32FN5O/c1-16(2)28-22(30)29-20-11-9-17(10-12-20)14-26-21(25-5)27-15-23(3,4)18-7-6-8-19(24)13-18/h6-13,16H,14-15H2,1-5H3,(H2,25,26,27)(H2,28,29,30) |
| InChIKey | IINIUVVBDBFFOQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|