C22H29F3IN5O — CID 111295988
1-[4-[[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide (PubChem CID 111295988) has the molecular formula C22H29F3IN5O and a molecular weight of 563.41 g/mol. Its IUPAC name is 1-[4-[[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide.
| Compound Name | 1-[4-[[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
|---|---|
| PubChem CID | 111295988 |
| Molecular Formula | C22H29F3IN5O |
| Molecular Weight | 563.41 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 1-[4-[[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(C(F)(F)F)cc1)NCc1ccc(NC(=O)NC(C)C)cc1.I |
| InChI | InChI=1S/C22H28F3N5O.HI/c1-15(2)29-21(31)30-19-10-6-17(7-11-19)14-28-20(26-3)27-13-12-16-4-8-18(9-5-16)22(23,24)25;/h4-11,15H,12-14H2,1-3H3,(H2,26,27,28)(H2,29,30,31);1H |
| InChIKey | IJKXBGFUSUBIBJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|