C21H28ClN5O — CID 111882805
1-[4-[[[N-[2-(2-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 111882805) has the molecular formula C21H28ClN5O and a molecular weight of 401.94 g/mol. Its IUPAC name is 1-[4-[[[N-[2-(2-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[[N-[2-(2-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 111882805 |
| Molecular Formula | C21H28ClN5O |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-[4-[[[N-[2-(2-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | C/N=C(\NCCc1ccccc1Cl)NCc1ccc(NC(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C21H28ClN5O/c1-15(2)26-21(28)27-18-10-8-16(9-11-18)14-25-20(23-3)24-13-12-17-6-4-5-7-19(17)22/h4-11,15H,12-14H2,1-3H3,(H2,23,24,25)(H2,26,27,28) |
| InChIKey | QXHVPBIKKLPVMA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|