C22H31N5OS — CID 111677582
1-[4-[[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 111677582) has the molecular formula C22H31N5OS and a molecular weight of 413.59 g/mol. Its IUPAC name is 1-[4-[[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 111677582 |
| Molecular Formula | C22H31N5OS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-[4-[[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | C/N=C(/NCc1ccc(NC(=O)NC(C)C)cc1)NCC(C)Sc1ccccc1 |
| InChI | InChI=1S/C22H31N5OS/c1-16(2)26-22(28)27-19-12-10-18(11-13-19)15-25-21(23-4)24-14-17(3)29-20-8-6-5-7-9-20/h5-13,16-17H,14-15H2,1-4H3,(H2,23,24,25)(H2,26,27,28) |
| InChIKey | PLWCBOHOMWLABI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|