C23H33N5O2 — CID 111686102
1-[4-[[[N'-methyl-N-[2-(3-methylphenoxy)propyl]carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 111686102) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-[4-[[[N'-methyl-N-[2-(3-methylphenoxy)propyl]carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[[N'-methyl-N-[2-(3-methylphenoxy)propyl]carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 111686102 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 1-[4-[[[N'-methyl-N-[2-(3-methylphenoxy)propyl]carbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | C/N=C(/NCc1ccc(NC(=O)NC(C)C)cc1)NCC(C)Oc1cccc(C)c1 |
| InChI | InChI=1S/C23H33N5O2/c1-16(2)27-23(29)28-20-11-9-19(10-12-20)15-26-22(24-5)25-14-18(4)30-21-8-6-7-17(3)13-21/h6-13,16,18H,14-15H2,1-5H3,(H2,24,25,26)(H2,27,28,29) |
| InChIKey | ZIAAJQBBLKYGTF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|