C22H30FN5O2 — CID 111678808
1-[4-[[[N-[2-(4-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 111678808) has the molecular formula C22H30FN5O2 and a molecular weight of 415.51 g/mol. Its IUPAC name is 1-[4-[[[N-[2-(4-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[[N-[2-(4-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 111678808 |
| Molecular Formula | C22H30FN5O2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-[4-[[[N-[2-(4-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | C/N=C(/NCc1ccc(NC(=O)NC(C)C)cc1)NCC(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C22H30FN5O2/c1-15(2)27-22(29)28-19-9-5-17(6-10-19)14-26-21(24-4)25-13-16(3)30-20-11-7-18(23)8-12-20/h5-12,15-16H,13-14H2,1-4H3,(H2,24,25,26)(H2,27,28,29) |
| InChIKey | GERHESYFCPOOAJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|