C23H30N4OS — CID 111676906
N-[3-[[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide (PubChem CID 111676906) has the molecular formula C23H30N4OS and a molecular weight of 410.59 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 111676906 |
| Molecular Formula | C23H30N4OS |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N-[3-[[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)C2CCC2)c1)NCC(C)Sc1ccccc1 |
| InChI | InChI=1S/C23H30N4OS/c1-17(29-21-12-4-3-5-13-21)15-25-23(24-2)26-16-18-8-6-11-20(14-18)27-22(28)19-9-7-10-19/h3-6,8,11-14,17,19H,7,9-10,15-16H2,1-2H3,(H,27,28)(H2,24,25,26) |
| InChIKey | PZXBIIUIXVUCSW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|