C25H35IN4O2 — CID 109409269
N-[3-[[[N-(3-hydroxy-2-phenylpropyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclohexanecarboxamide;hydroiodide (PubChem CID 109409269) has the molecular formula C25H35IN4O2 and a molecular weight of 550.49 g/mol. Its IUPAC name is N-[3-[[[N-(3-hydroxy-2-phenylpropyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclohexanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[N-(3-hydroxy-2-phenylpropyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclohexanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 109409269 |
| Molecular Formula | C25H35IN4O2 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | N-[3-[[[N-(3-hydroxy-2-phenylpropyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclohexanecarboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)C2CCCCC2)c1)NCC(CO)c1ccccc1.I |
| InChI | InChI=1S/C25H34N4O2.HI/c1-26-25(28-17-22(18-30)20-10-4-2-5-11-20)27-16-19-9-8-14-23(15-19)29-24(31)21-12-6-3-7-13-21;/h2,4-5,8-11,14-15,21-22,30H,3,6-7,12-13,16-18H2,1H3,(H,29,31)(H2,26,27,28);1H |
| InChIKey | ILZHWPXRXWDQEJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|