C23H29F2IN4O2 — CID 111866377
N-[3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide (PubChem CID 111866377) has the molecular formula C23H29F2IN4O2 and a molecular weight of 558.41 g/mol. Its IUPAC name is N-[3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111866377 |
| Molecular Formula | C23H29F2IN4O2 |
| Molecular Weight | 558.41 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | N-[3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)C2CCCC2)c1)NCc1ccccc1OC(F)F.I |
| InChI | InChI=1S/C23H28F2N4O2.HI/c1-26-23(28-15-18-10-4-5-12-20(18)31-22(24)25)27-14-16-7-6-11-19(13-16)29-21(30)17-8-2-3-9-17;/h4-7,10-13,17,22H,2-3,8-9,14-15H2,1H3,(H,29,30)(H2,26,27,28);1H |
| InChIKey | HVECWGYPWDHPEH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|