C24H33IN4O2 — CID 111417352
N-[3-[[[N'-methyl-N-(3-phenoxypropyl)carbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide (PubChem CID 111417352) has the molecular formula C24H33IN4O2 and a molecular weight of 536.46 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-(3-phenoxypropyl)carbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[N'-methyl-N-(3-phenoxypropyl)carbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111417352 |
| Molecular Formula | C24H33IN4O2 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | N-[3-[[[N'-methyl-N-(3-phenoxypropyl)carbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCOc1ccccc1)NCc1cccc(NC(=O)C2CCCC2)c1.I |
| InChI | InChI=1S/C24H32N4O2.HI/c1-25-24(26-15-8-16-30-22-13-3-2-4-14-22)27-18-19-9-7-12-21(17-19)28-23(29)20-10-5-6-11-20;/h2-4,7,9,12-14,17,20H,5-6,8,10-11,15-16,18H2,1H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | CAAUTGCDFZJWRK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|