C22H29N5O — CID 110969138
N-[3-[[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]methyl]phenyl]cyclohexanecarboxamide (PubChem CID 110969138) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]methyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]methyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 110969138 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | N-[3-[[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]methyl]phenyl]cyclohexanecarboxamide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)C2CCCCC2)c1)NCc1ccccn1 |
| InChI | InChI=1S/C22H29N5O/c1-23-22(26-16-20-11-5-6-13-24-20)25-15-17-8-7-12-19(14-17)27-21(28)18-9-3-2-4-10-18/h5-8,11-14,18H,2-4,9-10,15-16H2,1H3,(H,27,28)(H2,23,25,26) |
| InChIKey | XXWPNJYBCZZTEE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|