C25H35IN4O3 — CID 109460343
N-[3-[[[N-[3-(3-methoxypropoxy)phenyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide (PubChem CID 109460343) has the molecular formula C25H35IN4O3 and a molecular weight of 566.48 g/mol. Its IUPAC name is N-[3-[[[N-[3-(3-methoxypropoxy)phenyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[N-[3-(3-methoxypropoxy)phenyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 109460343 |
| Molecular Formula | C25H35IN4O3 |
| Molecular Weight | 566.48 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | N-[3-[[[N-[3-(3-methoxypropoxy)phenyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)C2CCCC2)c1)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C25H34N4O3.HI/c1-26-25(29-22-12-6-13-23(17-22)32-15-7-14-31-2)27-18-19-8-5-11-21(16-19)28-24(30)20-9-3-4-10-20;/h5-6,8,11-13,16-17,20H,3-4,7,9-10,14-15,18H2,1-2H3,(H,28,30)(H2,26,27,29);1H |
| InChIKey | FTKDWUHAHQXOOC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|