C18H20F2N4O2 — CID 111865562
3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide (PubChem CID 111865562) has the molecular formula C18H20F2N4O2 and a molecular weight of 362.38 g/mol. Its IUPAC name is 3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide.
| Compound Name | 3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111865562 |
| Molecular Formula | C18H20F2N4O2 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCc1cccc(C(N)=O)c1)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C18H20F2N4O2/c1-22-18(23-10-12-5-4-7-13(9-12)16(21)25)24-11-14-6-2-3-8-15(14)26-17(19)20/h2-9,17H,10-11H2,1H3,(H2,21,25)(H2,22,23,24) |
| InChIKey | GQVKDWCQRYFJAY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|